CAS 148345-63-5 appears in our catalog under these names: Methyl 3-(5-Tetrazolyl)benzoate, Methyl 3-(5-Tetrazolyl)benzoate, 95%, 95%, methyl 3-(1H-1,2,3,4-tetrazol-5-yl)benzoate, 95%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg.
Methyl 3-(2H-tetrazol-5-yl)benzoate (CAS 148345-63-5) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: methyl 3-(2H-tetrazol-5-yl)benzoate. InChIKey: XHDHEDITROOBDC-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | methyl 3-(2H-tetrazol-5-yl)benzoate |
| InChIKey | XHDHEDITROOBDC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2=NNN=N2 |
Computed by PubChem (NCBI)