CAS 148438-02-2 appears in our catalog under these names: Methyl 3-cyclopropylbenzoate, 95-<97%, Methyl 3-cyclopropylbenzoate, ≥97-<99%, Methyl 3-cyclopropylbenzoate, 97%. Offered by: Hoffman Fine Chemicals, AmBeed. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 1g.
Methyl 3-cyclopropylbenzoate (CAS 148438-02-2) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: methyl 3-cyclopropylbenzoate. InChIKey: RMRWUOLENFUPHL-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | methyl 3-cyclopropylbenzoate |
| InChIKey | RMRWUOLENFUPHL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=CC(=C1)C2CC2 |
Computed by PubChem (NCBI)