Products 1485398-05-7

CAS 1485398-05-7 is the registry number for Phenyl 3-hydroxy-3-methylazetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Phenyl 3-hydroxy-3-methylazetidine-1-carboxylate (CAS 1485398-05-7) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: phenyl 3-hydroxy-3-methylazetidine-1-carboxylate. InChIKey: JKKVDTYOHWNKSR-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO3
Molecular weight207.23 g/mol
IUPAC namephenyl 3-hydroxy-3-methylazetidine-1-carboxylate
InChIKeyJKKVDTYOHWNKSR-UHFFFAOYSA-N
SMILESCC1(CN(C1)C(=O)OC2=CC=CC=C2)O

Computed by PubChem (NCBI)