CAS 1485398-05-7 is the registry number for Phenyl 3-hydroxy-3-methylazetidine-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Phenyl 3-hydroxy-3-methylazetidine-1-carboxylate (CAS 1485398-05-7) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: phenyl 3-hydroxy-3-methylazetidine-1-carboxylate. InChIKey: JKKVDTYOHWNKSR-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | phenyl 3-hydroxy-3-methylazetidine-1-carboxylate |
| InChIKey | JKKVDTYOHWNKSR-UHFFFAOYSA-N |
| SMILES | CC1(CN(C1)C(=O)OC2=CC=CC=C2)O |
Computed by PubChem (NCBI)