CAS 1485645-67-7 appears in our catalog under these names: 6-Chloro-3,4-dihydro-2h-1,4-benzoxazine-2-carboxylic acid, 95%, 6-Chloro-3,4-dihydro-2H-benzo(b)(1,4)oxazine-2-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid (CAS 1485645-67-7) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid. InChIKey: ZVDAUGDLMLQGFD-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carboxylic acid |
| InChIKey | ZVDAUGDLMLQGFD-UHFFFAOYSA-N |
| SMILES | C1C(OC2=C(N1)C=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)