Products 1486650-44-5
CAS 1486650-44-5 appears in our catalog under these names: 1-Isobutyl-3-methyl-1h-pyrazole-5-carboxylic acid, 95%, 1-Isobutyl-3-methyl-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
5-methyl-2-(2-methylpropyl)pyrazole-3-carboxylic acid (CAS 1486650-44-5) is a chemical compound with the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. IUPAC name: 5-methyl-2-(2-methylpropyl)pyrazole-3-carboxylic acid. InChIKey: ZVYOPEQPQYGALU-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2 |
|---|---|
| Molecular weight | 182.22 g/mol |
| IUPAC name | 5-methyl-2-(2-methylpropyl)pyrazole-3-carboxylic acid |
| InChIKey | ZVYOPEQPQYGALU-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)O)CC(C)C |
Computed by PubChem (NCBI)