Products 14933-24-5
CAS 14933-24-5 is the registry number for 3-Bromo-4-hydroxyquinolin-2(1H)-one, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
3-bromo-4-hydroxy-1H-quinolin-2-one (CAS 14933-24-5) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 3-bromo-4-hydroxy-1H-quinolin-2-one. InChIKey: JJVRAMNFIQYYMP-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 3-bromo-4-hydroxy-1H-quinolin-2-one |
| InChIKey | JJVRAMNFIQYYMP-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=C(C(=O)N2)Br)O |
Computed by PubChem (NCBI)