CAS 1494082-13-1 is the registry number for (5,7-Dimethyl-1-benzofuran-2-yl)methanol, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
(5,7-dimethyl-1-benzofuran-2-yl)methanol (CAS 1494082-13-1) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: (5,7-dimethyl-1-benzofuran-2-yl)methanol. InChIKey: QZAYQUPUENSWKB-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | (5,7-dimethyl-1-benzofuran-2-yl)methanol |
| InChIKey | QZAYQUPUENSWKB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C=C(O2)CO)C |
Computed by PubChem (NCBI)