Products 1494527-01-3
CAS 1494527-01-3 is the registry number for 1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile, 95%. Offered by: Chemat. Available pack sizes: 1g.
1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile (CAS 1494527-01-3) is a chemical compound with the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. IUPAC name: 1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile. InChIKey: WSRSGQSCZLWBKN-UHFFFAOYSA-N.
| Molecular formula | C13H14BrNO2 |
|---|---|
| Molecular weight | 296.16 g/mol |
| IUPAC name | 1-(3-bromophenyl)-3,3-dimethoxycyclobutane-1-carbonitrile |
| InChIKey | WSRSGQSCZLWBKN-UHFFFAOYSA-N |
| SMILES | COC1(CC(C1)(C#N)C2=CC(=CC=C2)Br)OC |
Computed by PubChem (NCBI)