CAS 14948-94-8 appears in our catalog under these names: 2-Naphthimidamide hydrochloride, 95+%, beta-Naphthamidine Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1g.
Naphthalene-2-carboximidamide;hydrochloride (CAS 14948-94-8) is a chemical compound with the molecular formula C11H11ClN2 and a molecular weight of 206.67 g/mol. IUPAC name: naphthalene-2-carboximidamide;hydrochloride. InChIKey: IGXALCCFUFBKQT-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2 |
|---|---|
| Molecular weight | 206.67 g/mol |
| IUPAC name | naphthalene-2-carboximidamide;hydrochloride |
| InChIKey | IGXALCCFUFBKQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)C(=N)N.Cl |
Computed by PubChem (NCBI)