CAS 149686-06-6 appears in our catalog under these names: N-(2-Methoxy-5-nitrophenyl)formamide, 95+%, 2-Methoxy-5-nitroformanilide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 500mg, 5g.
N-(2-methoxy-5-nitrophenyl)formamide (CAS 149686-06-6) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: N-(2-methoxy-5-nitrophenyl)formamide. InChIKey: WMFURCICLSTGEJ-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | N-(2-methoxy-5-nitrophenyl)formamide |
| InChIKey | WMFURCICLSTGEJ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N+](=O)[O-])NC=O |
Computed by PubChem (NCBI)