CAS 149709-49-9 appears in our catalog under these names: Valsartan Impurity 44, Sacubitril Impurity 16, (2R,4S)-5-([1,1'-Biphenyl]-4-yl)-4-(4-ethoxy-4-oxobutanamido)-2-methylpentanoic acid, 98%, Sacubitril Impurity 35, (2R,4S)-5-((1,1'-Biphenyl)-4-yl)-4-(4-ethoxy-4-oxobutanamido)-2-methylpentanoic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
(2R,4S)-4-[(4-ethoxy-4-oxobutanoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoic acid (CAS 149709-49-9) is a chemical compound with the molecular formula C24H29NO5 and a molecular weight of 411.5 g/mol. IUPAC name: (2R,4S)-4-[(4-ethoxy-4-oxobutanoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoic acid. InChIKey: AUNLGZJEDPUZSE-UTKZUKDTSA-N.
| Molecular formula | C24H29NO5 |
|---|---|
| Molecular weight | 411.5 g/mol |
| IUPAC name | (2R,4S)-4-[(4-ethoxy-4-oxobutanoyl)amino]-2-methyl-5-(4-phenylphenyl)pentanoic acid |
| InChIKey | AUNLGZJEDPUZSE-UTKZUKDTSA-N |
| SMILES | CCOC(=O)CCC(=O)N[C@H](CC1=CC=C(C=C1)C2=CC=CC=C2)C[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)