CAS 1497321-53-5 is the registry number for Ethyl 5-(2-methylthiazol-4-yl)-1H-1,2,4-triazole-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 3-(2-methyl-1,3-thiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate (CAS 1497321-53-5) is a chemical compound with the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. IUPAC name: ethyl 3-(2-methyl-1,3-thiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate. InChIKey: QSUQIZAAYGSXLV-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | ethyl 3-(2-methyl-1,3-thiazol-4-yl)-1H-1,2,4-triazole-5-carboxylate |
| InChIKey | QSUQIZAAYGSXLV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=NC(=NN1)C2=CSC(=N2)C |
Computed by PubChem (NCBI)