CAS 2287313-59-9 is the registry number for 3-(4-Amino-1H-benzo[d][1,2,3]triazol-1-yl)thietane 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(1,1-dioxothietan-3-yl)benzotriazol-4-amine (CAS 2287313-59-9) is a chemical compound with the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. IUPAC name: 1-(1,1-dioxothietan-3-yl)benzotriazol-4-amine. InChIKey: CVNZMRFPFBQTGN-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | 1-(1,1-dioxothietan-3-yl)benzotriazol-4-amine |
| InChIKey | CVNZMRFPFBQTGN-UHFFFAOYSA-N |
| SMILES | C1C(CS1(=O)=O)N2C3=CC=CC(=C3N=N2)N |
Computed by PubChem (NCBI)