CAS 1893636-11-7 is the registry number for 2-(1H-[1,2,3]Triazolo[4,5-c]pyridin-1-yl)tetrahydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(triazolo[4,5-c]pyridin-1-yl)thiolane 1,1-dioxide (CAS 1893636-11-7) is a chemical compound with the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. IUPAC name: 2-(triazolo[4,5-c]pyridin-1-yl)thiolane 1,1-dioxide. InChIKey: USTXOLQUIUMOPN-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | 2-(triazolo[4,5-c]pyridin-1-yl)thiolane 1,1-dioxide |
| InChIKey | USTXOLQUIUMOPN-UHFFFAOYSA-N |
| SMILES | C1CC(S(=O)(=O)C1)N2C3=C(C=NC=C3)N=N2 |
Computed by PubChem (NCBI)