Products 937618-40-1
CAS 937618-40-1 is the registry number for N-(Cyclopropylmethyl)-5-nitroimidazo[2,1-b]thiazol-6-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(cyclopropylmethyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine (CAS 937618-40-1) is a chemical compound with the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. IUPAC name: N-(cyclopropylmethyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine. InChIKey: FRMWLIBRIWMUCH-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | N-(cyclopropylmethyl)-5-nitroimidazo[2,1-b][1,3]thiazol-6-amine |
| InChIKey | FRMWLIBRIWMUCH-UHFFFAOYSA-N |
| SMILES | C1CC1CNC2=C(N3C=CSC3=N2)[N+](=O)[O-] |
Computed by PubChem (NCBI)