CAS 58390-58-2 appears in our catalog under these names: 3-(Benzylsulfonyl)-1h-1,2,4-triazol-5-amine, 95%, 5-(Benzylsulfonyl)-1H-1,2,4-triazol-3-amine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
5-benzylsulfonyl-1H-1,2,4-triazol-3-amine (CAS 58390-58-2) is a chemical compound with the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. IUPAC name: 5-benzylsulfonyl-1H-1,2,4-triazol-3-amine. InChIKey: MLZSFHYAJVDZQF-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | 5-benzylsulfonyl-1H-1,2,4-triazol-3-amine |
| InChIKey | MLZSFHYAJVDZQF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CS(=O)(=O)C2=NC(=NN2)N |
Computed by PubChem (NCBI)