CAS 863668-01-3 is the registry number for (2-Mercapto-5,7-dimethyl[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(5,7-dimethyl-2-sulfanylidene-1H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid (CAS 863668-01-3) is a chemical compound with the molecular formula C9H10N4O2S and a molecular weight of 238.27 g/mol. IUPAC name: 2-(5,7-dimethyl-2-sulfanylidene-1H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid. InChIKey: HZSQLWMMMHMXGS-UHFFFAOYSA-N.
| Molecular formula | C9H10N4O2S |
|---|---|
| Molecular weight | 238.27 g/mol |
| IUPAC name | 2-(5,7-dimethyl-2-sulfanylidene-1H-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)acetic acid |
| InChIKey | HZSQLWMMMHMXGS-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=NC(=S)NN12)C)CC(=O)O |
Computed by PubChem (NCBI)