CAS 149809-26-7 is the registry number for 1-(6-Aminobenzo[d][1,3]dioxol-5-yl)-2-chloroethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(6-amino-1,3-benzodioxol-5-yl)-2-chloroethanone (CAS 149809-26-7) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 1-(6-amino-1,3-benzodioxol-5-yl)-2-chloroethanone. InChIKey: PRSCCOTYRGOTJG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 1-(6-amino-1,3-benzodioxol-5-yl)-2-chloroethanone |
| InChIKey | PRSCCOTYRGOTJG-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)C(=O)CCl)N |
Computed by PubChem (NCBI)