CAS 149809-34-7 is the registry number for Posaconazole Impurity 189. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-difluorophenyl)prop-2-enyl acetate (CAS 149809-34-7) is a chemical compound with the molecular formula C11H10F2O2 and a molecular weight of 212.19 g/mol. IUPAC name: 2-(2,4-difluorophenyl)prop-2-enyl acetate. InChIKey: RFICPHKOIPFHNZ-UHFFFAOYSA-N.
| Molecular formula | C11H10F2O2 |
|---|---|
| Molecular weight | 212.19 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)prop-2-enyl acetate |
| InChIKey | RFICPHKOIPFHNZ-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC(=C)C1=C(C=C(C=C1)F)F |
Computed by PubChem (NCBI)