CAS 1498323-18-4 is the registry number for Neluxicapone. Offered by: MedChemExpress. Available pack sizes: Get quote.
4,5-dihydroxy-2-[(4-methylphenyl)methyl]benzene-1,3-dicarbonitrile (CAS 1498323-18-4) is a chemical compound with the molecular formula C16H12N2O2 and a molecular weight of 264.28 g/mol. IUPAC name: 4,5-dihydroxy-2-[(4-methylphenyl)methyl]benzene-1,3-dicarbonitrile. InChIKey: GILLLKMLIBNDKV-UHFFFAOYSA-N.
| Molecular formula | C16H12N2O2 |
|---|---|
| Molecular weight | 264.28 g/mol |
| IUPAC name | 4,5-dihydroxy-2-[(4-methylphenyl)methyl]benzene-1,3-dicarbonitrile |
| InChIKey | GILLLKMLIBNDKV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC2=C(C(=C(C=C2C#N)O)O)C#N |
Computed by PubChem (NCBI)