Products 1500530-79-9
CAS 1500530-79-9 appears in our catalog under these names: 3-Methyl-1-(pyridin-4-ylmethyl)-1h-pyrazole-5-carboxylic acid, 95%, 3-Methyl-1-(pyridin-4-ylmethyl)-1H-pyrazole-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
5-methyl-2-(pyridin-4-ylmethyl)pyrazole-3-carboxylic acid (CAS 1500530-79-9) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: 5-methyl-2-(pyridin-4-ylmethyl)pyrazole-3-carboxylic acid. InChIKey: SBIBOEGHHLWQAJ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | 5-methyl-2-(pyridin-4-ylmethyl)pyrazole-3-carboxylic acid |
| InChIKey | SBIBOEGHHLWQAJ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C(=C1)C(=O)O)CC2=CC=NC=C2 |
Computed by PubChem (NCBI)