CAS 1501132-92-8 appears in our catalog under these names: Methyl 4-chloro-2-(propan-2-yl)-1,3-thiazole-5-carboxylate, 95%, Methyl 4-chloro-2-(propan-2-yl)-1,3-thiazole-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 4-chloro-2-propan-2-yl-1,3-thiazole-5-carboxylate (CAS 1501132-92-8) is a chemical compound with the molecular formula C8H10ClNO2S and a molecular weight of 219.69 g/mol. IUPAC name: methyl 4-chloro-2-propan-2-yl-1,3-thiazole-5-carboxylate. InChIKey: TXRCYOWKQPQXFD-UHFFFAOYSA-N.
| Molecular formula | C8H10ClNO2S |
|---|---|
| Molecular weight | 219.69 g/mol |
| IUPAC name | methyl 4-chloro-2-propan-2-yl-1,3-thiazole-5-carboxylate |
| InChIKey | TXRCYOWKQPQXFD-UHFFFAOYSA-N |
| SMILES | CC(C)C1=NC(=C(S1)C(=O)OC)Cl |
Computed by PubChem (NCBI)