CAS 15026-75-2 appears in our catalog under these names: 3-Formamido-4-Hydroxybenzoic Acid, 3-(Formylamino)-4-hydroxybenzoic acid, 95-<97%. Offered by: Chemat Brand, Hoffman Fine Chemicals. Available pack sizes: on request, 2,5g, 5g, 10g, 25g, 50g, 100g.
3-formamido-4-hydroxybenzoic acid (CAS 15026-75-2) is a chemical compound with the molecular formula C8H7NO4 and a molecular weight of 181.15 g/mol. IUPAC name: 3-formamido-4-hydroxybenzoic acid. InChIKey: OGVQNMUUNMMAMS-UHFFFAOYSA-N.
| Molecular formula | C8H7NO4 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 3-formamido-4-hydroxybenzoic acid |
| InChIKey | OGVQNMUUNMMAMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)NC=O)O |
Computed by PubChem (NCBI)