Products 150319-83-8
CAS 150319-83-8 appears in our catalog under these names: Methyl 3-aminophenylacetate hydrochloride, 98%, Methyl 3-aminophenylacetate hydrochloride, Methyl 3-aminophenylacetate HCl 98%, Methyl 3-aminophenylacetate, HCl, 98%, 98%, Methyl 2-(3-aminophenyl)acetate hydrochloride, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g.
Methyl 2-(3-aminophenyl)acetate;hydrochloride (CAS 150319-83-8) is a chemical compound with the molecular formula C9H12ClNO2 and a molecular weight of 201.65 g/mol. IUPAC name: methyl 2-(3-aminophenyl)acetate;hydrochloride. InChIKey: OOGVJPZOIXNNHQ-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO2 |
|---|---|
| Molecular weight | 201.65 g/mol |
| IUPAC name | methyl 2-(3-aminophenyl)acetate;hydrochloride |
| InChIKey | OOGVJPZOIXNNHQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=CC=C1)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Methyl 2-(3-aminophenyl)acetate hydrochloride, Methyl 3-aminophenylacetate hydrochloride, 3-Aminophenylacetic acid methyl ester HCl, Methyl 3-aminophenylacetate, HCl, methyl 2-(3-aminophenyl)acetate;hydrochloride, 3-Aminophenylacetic acid methyl ester hydrochloride, 3-amino phenylacetic acid methylester hydrochloride, 3-amino phenylacetic, Methyl (3-aminophenyl)acetate hydrochloride, OOGVJPZOIXNNHQ-UHFFFAOYSA-N