Products 1503244-36-7
CAS 1503244-36-7 is the registry number for 2-(2,4-Dioxo-1,2-dihydropyrrolo[2,1-f][1,2,4]triazin-3(4H)-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-dioxo-1H-pyrrolo[2,1-f][1,2,4]triazin-3-yl)acetic acid (CAS 1503244-36-7) is a chemical compound with the molecular formula C8H7N3O4 and a molecular weight of 209.16 g/mol. IUPAC name: 2-(2,4-dioxo-1H-pyrrolo[2,1-f][1,2,4]triazin-3-yl)acetic acid. InChIKey: NIFZYSJZWPMXQO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O4 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 2-(2,4-dioxo-1H-pyrrolo[2,1-f][1,2,4]triazin-3-yl)acetic acid |
| InChIKey | NIFZYSJZWPMXQO-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=O)N(C(=O)N2)CC(=O)O |
Computed by PubChem (NCBI)