Products 65426-59-7
CAS 65426-59-7 is the registry number for 4-Nitroisophthalamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-nitrobenzene-1,4-dicarboxamide (CAS 65426-59-7) is a chemical compound with the molecular formula C8H7N3O4 and a molecular weight of 209.16 g/mol. IUPAC name: 2-nitrobenzene-1,4-dicarboxamide. InChIKey: KTBCABLQCOTTPG-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O4 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 2-nitrobenzene-1,4-dicarboxamide |
| InChIKey | KTBCABLQCOTTPG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)N)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)