CAS 32114-73-1 appears in our catalog under these names: 2-Nitroisophthalamide, 95%, 2–Nitroisophthalamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
2-nitrobenzene-1,3-dicarboxamide (CAS 32114-73-1) is a chemical compound with the molecular formula C8H7N3O4 and a molecular weight of 209.16 g/mol. IUPAC name: 2-nitrobenzene-1,3-dicarboxamide. InChIKey: SGVRCXLEYPXYIS-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O4 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 2-nitrobenzene-1,3-dicarboxamide |
| InChIKey | SGVRCXLEYPXYIS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)N)[N+](=O)[O-])C(=O)N |
Computed by PubChem (NCBI)