CAS 861332-65-2 appears in our catalog under these names: N-(3-Nitrophenyl)ethanediamide, 95%, N-(3-Nitrophenyl)ethanediamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N'-(3-nitrophenyl)oxamide (CAS 861332-65-2) is a chemical compound with the molecular formula C8H7N3O4 and a molecular weight of 209.16 g/mol. IUPAC name: N'-(3-nitrophenyl)oxamide. InChIKey: PJIBMTOUMHBAMK-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O4 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | N'-(3-nitrophenyl)oxamide |
| InChIKey | PJIBMTOUMHBAMK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC(=O)C(=O)N |
Computed by PubChem (NCBI)