CAS 896630-35-6 is the registry number for 2-(3-Methyl-4-oxoisoxazolo[5,4-d]pyrimidin-5(4H)-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid (CAS 896630-35-6) is a chemical compound with the molecular formula C8H7N3O4 and a molecular weight of 209.16 g/mol. IUPAC name: 2-(3-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid. InChIKey: BRFHSTOWYHCSPG-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O4 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 2-(3-methyl-4-oxo-[1,2]oxazolo[5,4-d]pyrimidin-5-yl)acetic acid |
| InChIKey | BRFHSTOWYHCSPG-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=O)N(C=N2)CC(=O)O |
Computed by PubChem (NCBI)