CAS 885524-69-6 appears in our catalog under these names: 6-Amino-7-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-one, 95%, 6-Amino-7-nitro-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6-amino-7-nitro-4H-1,4-benzoxazin-3-one (CAS 885524-69-6) is a chemical compound with the molecular formula C8H7N3O4 and a molecular weight of 209.16 g/mol. IUPAC name: 6-amino-7-nitro-4H-1,4-benzoxazin-3-one. InChIKey: UKMPWBSPQZCXLA-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O4 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | 6-amino-7-nitro-4H-1,4-benzoxazin-3-one |
| InChIKey | UKMPWBSPQZCXLA-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=C(O1)C=C(C(=C2)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)