Products 1503788-07-5
CAS 1503788-07-5 is the registry number for α-Amylase-IN-8. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-amino-6-(3-methoxyphenyl)sulfanylpyridine-3-carboxylic acid (CAS 1503788-07-5) is a chemical compound with the molecular formula C13H12N2O3S and a molecular weight of 276.31 g/mol. IUPAC name: 5-amino-6-(3-methoxyphenyl)sulfanylpyridine-3-carboxylic acid. InChIKey: MESYKGQIEHKKDJ-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O3S |
|---|---|
| Molecular weight | 276.31 g/mol |
| IUPAC name | 5-amino-6-(3-methoxyphenyl)sulfanylpyridine-3-carboxylic acid |
| InChIKey | MESYKGQIEHKKDJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)SC2=C(C=C(C=N2)C(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
alpha-Amylase-IN-8, orb2665426