CAS 1505150-85-5 appears in our catalog under these names: 2-Nitro-3-phenoxyaniline, 95%, 2-Nitro-3-phenoxyaniline. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-nitro-3-phenoxyaniline (CAS 1505150-85-5) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 2-nitro-3-phenoxyaniline. InChIKey: NCYDKALUEOLSFQ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 2-nitro-3-phenoxyaniline |
| InChIKey | NCYDKALUEOLSFQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC=CC(=C2[N+](=O)[O-])N |
Computed by PubChem (NCBI)