Products 150571-02-1
CAS 150571-02-1 is the registry number for 3-((3,5-Dichlorophenyl)amino)propanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
3-(3,5-dichloroanilino)propanoic acid (CAS 150571-02-1) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: 3-(3,5-dichloroanilino)propanoic acid. InChIKey: JLQFNPSDKJAWCH-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | 3-(3,5-dichloroanilino)propanoic acid |
| InChIKey | JLQFNPSDKJAWCH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)NCCC(=O)O |
Computed by PubChem (NCBI)