Products 1506544-79-1
CAS 1506544-79-1 is the registry number for 5,6,7,8-Tetrahydronaphthalen-2-yl chloroformate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,6,7,8-tetrahydronaphthalen-2-yl carbonochloridate (CAS 1506544-79-1) is a chemical compound with the molecular formula C11H11ClO2 and a molecular weight of 210.65 g/mol. IUPAC name: 5,6,7,8-tetrahydronaphthalen-2-yl carbonochloridate. InChIKey: ACODUOARMQEISS-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO2 |
|---|---|
| Molecular weight | 210.65 g/mol |
| IUPAC name | 5,6,7,8-tetrahydronaphthalen-2-yl carbonochloridate |
| InChIKey | ACODUOARMQEISS-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=CC(=C2)OC(=O)Cl |
Computed by PubChem (NCBI)