CAS 150670-63-6 appears in our catalog under these names: 3,4-Dihydrocyclopenta(b)indol-2(1H)-one, 97%, 1H,2H,3H,4H-Cyclopenta(b)indol-2-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
3,4-dihydro-1H-cyclopenta[b]indol-2-one (CAS 150670-63-6) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 3,4-dihydro-1H-cyclopenta[b]indol-2-one. InChIKey: CVBVNBVUPNOKSL-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 3,4-dihydro-1H-cyclopenta[b]indol-2-one |
| InChIKey | CVBVNBVUPNOKSL-UHFFFAOYSA-N |
| SMILES | C1C(=O)CC2=C1C3=CC=CC=C3N2 |
Computed by PubChem (NCBI)