Products 150730-41-9
CAS 150730-41-9 appears in our catalog under these names: Dimethyl 4-aminopyridine-2,6-dicarboxylate, 98%, 98%, Dimethyl 4-aminopyridine-2,6-dicarboxylate, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g.
Dimethyl 4-aminopyridine-2,6-dicarboxylate (CAS 150730-41-9) is a chemical compound with the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. IUPAC name: dimethyl 4-aminopyridine-2,6-dicarboxylate. InChIKey: MZTSUWWTESDXNW-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O4 |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | dimethyl 4-aminopyridine-2,6-dicarboxylate |
| InChIKey | MZTSUWWTESDXNW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC(=N1)C(=O)OC)N |
Computed by PubChem (NCBI)