Products 150907-52-1
CAS 150907-52-1 appears in our catalog under these names: 2,4–D–13C6, 2,4-Dichlorophenoxyacetic Acid-13C6, >95% (HPLC), 2,4-D 13C6 100 µg/mL in Acetone, 2，4-D-13C6, 2,4-D-13C6, 97.47%. Offered by: GLPBio, TRC, Dr. Ehrenstorfer, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 1ml, 5 mg, 1 mg, 1x1ml.
2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid (CAS 150907-52-1) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 226.99 g/mol. IUPAC name: 2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid. InChIKey: OVSKIKFHRZPJSS-JTZKEMBVSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 226.99 g/mol |
| IUPAC name | 2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid |
| InChIKey | OVSKIKFHRZPJSS-JTZKEMBVSA-N |
| SMILES | [13CH]1=[13CH][13C](=[13C]([13CH]=[13C]1Cl)Cl)OCC(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dichlorophenoxyacetic Acid-13C6, 2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid, Acetic acid, (2,4-dichlorophenoxy-13C6)- (9CI), Acetic acid, (2,4-dichlorophenoxy-13C6)- (9CI); 2,4-D (phenyl-13C6); 2,4-D 13C6, 2,4-D 13C6 100 |Ig/mL in Acetone, 2,4-D 13C6 100 microg/mL in Acetone, {[2,4-Dichloro(~13~C_6_)phenyl]oxy}acetic acid