Products 7606-87-3
CAS 7606-87-3 is the registry number for Methyl 3,5-dichloro-2-hydroxybenzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Methyl 3,5-dichloro-2-hydroxybenzoate (CAS 7606-87-3) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: methyl 3,5-dichloro-2-hydroxybenzoate. InChIKey: WFPHSUSTKMYQDI-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | methyl 3,5-dichloro-2-hydroxybenzoate |
| InChIKey | WFPHSUSTKMYQDI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)Cl)O |
Computed by PubChem (NCBI)
Synonyms:
Benzoic acid, 3,5-dichloro-2-hydroxy-, methyl ester, 3,5-Dichlorosalicylic acid, methyl ester, Salicylic acid, 3,35-dichloro-, methyl ester, methyl 3,5-dichloro-2-hydroxybenzoate, methyl 3,5-dichlorosalicylate, Methyl-3,5-dichlorosalicylate, methyl3,5-dichloro-2-hydroxybenzoate, methyl 3,5-dichloro-2-hydroxy-benzoate