CAS 22775-37-7 appears in our catalog under these names: 3,5-Dichloro-2-methoxybenzoic acid, 95%, 3,5-Dichloro-2-methoxybenzoic acid, 3,5-dichloro-2-methoxybenzoic acid, 98%, 98%, 3,5-Dichloro-2-methoxybenzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 500mg, 250mg, 1000mg, 2000mg, 100mg, 10g.
3,5-dichloro-2-methoxybenzoic acid (CAS 22775-37-7) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 3,5-dichloro-2-methoxybenzoic acid. InChIKey: AUVSCSCAPKFMEK-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 3,5-dichloro-2-methoxybenzoic acid |
| InChIKey | AUVSCSCAPKFMEK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)