CAS 582-54-7 appears in our catalog under these names: (2,5-Dichlorophenoxy)acetic acid, 95%, 2-(2,5-Dichlorophenoxy)acetic acid 95%, 2-(2,5-Dichlorophenoxy)acetic acid, 95%, 95%, 2,5-D, (2,5-dichlorophenoxy)acetic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, HPC Standards, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg, 1x10mg.
2-(2,5-dichlorophenoxy)acetic acid (CAS 582-54-7) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(2,5-dichlorophenoxy)acetic acid. InChIKey: YVPLLFUCNGVUAY-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(2,5-dichlorophenoxy)acetic acid |
| InChIKey | YVPLLFUCNGVUAY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)OCC(=O)O)Cl |
Computed by PubChem (NCBI)