CAS 575-90-6 appears in our catalog under these names: 2-(2,6-Dichlorophenoxy)acetic acid, 95%, 2,6-D, 2–(2,6–Dichlorophenoxy)acetic acid, 2-(2,6-dichlorophenoxy)acetic Acid, 2,6-D acid 97%. Offered by: Combi-blocks, Dr. Ehrenstorfer, GLPBio, Biosynth, Ambeed. Available pack sizes: 5g, 1g, 250mg, 10g, 10mg, 100mg, 1x10mg, 1x10ml.
2-(2,6-dichlorophenoxy)acetic acid (CAS 575-90-6) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(2,6-dichlorophenoxy)acetic acid. InChIKey: KHZWIIFEFQBNKL-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(2,6-dichlorophenoxy)acetic acid |
| InChIKey | KHZWIIFEFQBNKL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCC(=O)O)Cl |
Computed by PubChem (NCBI)