CAS 1509809-62-4 appears in our catalog under these names: 3-(3,5-Difluorophenyl)cyclobutan-1-one, 95%, 3-(3,5-Difluorophenyl)cyclobutan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
3-(3,5-difluorophenyl)cyclobutan-1-one (CAS 1509809-62-4) is a chemical compound with the molecular formula C10H8F2O and a molecular weight of 182.17 g/mol. IUPAC name: 3-(3,5-difluorophenyl)cyclobutan-1-one. InChIKey: KIIMGOWLSXDMQT-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O |
|---|---|
| Molecular weight | 182.17 g/mol |
| IUPAC name | 3-(3,5-difluorophenyl)cyclobutan-1-one |
| InChIKey | KIIMGOWLSXDMQT-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)