Products 151099-18-2
CAS 151099-18-2 is the registry number for 6-Bromo-7-methyl-1,8-naphthyridin-4-ol. Offered by: TRC. Available pack sizes: 250mg.
6-bromo-7-methyl-1H-1,8-naphthyridin-4-one (CAS 151099-18-2) is a chemical compound with the molecular formula C9H7BrN2O and a molecular weight of 239.07 g/mol. IUPAC name: 6-bromo-7-methyl-1H-1,8-naphthyridin-4-one. InChIKey: GMWZPVNIMVUDTO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrN2O |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 6-bromo-7-methyl-1H-1,8-naphthyridin-4-one |
| InChIKey | GMWZPVNIMVUDTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C2C(=O)C=CNC2=N1)Br |
Computed by PubChem (NCBI)