CAS 151258-67-2 appears in our catalog under these names: 5-Methyl-2-(1h-pyrrol-1-yl)thiophene-3-carboxylic acid, 95%, 5-Methyl-2-(1H-pyrrol-1-yl)thiophene-3-carboxylic acid, 95+%, 5-Methyl-2-(1H-pyrrol-1-yl)thiophene-3-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg.
5-methyl-2-pyrrol-1-ylthiophene-3-carboxylic acid (CAS 151258-67-2) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 5-methyl-2-pyrrol-1-ylthiophene-3-carboxylic acid. InChIKey: GHQHUPKIJXQWKT-UHFFFAOYSA-N.
| Molecular formula | C10H9NO2S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 5-methyl-2-pyrrol-1-ylthiophene-3-carboxylic acid |
| InChIKey | GHQHUPKIJXQWKT-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(S1)N2C=CC=C2)C(=O)O |
Computed by PubChem (NCBI)