CAS 15128-08-2 appears in our catalog under these names: 2–Nitro–3–hydroxypyridine, 2-Nitro-3-hydroxypyridine, 98%+,RG, 98%+,RG. Offered by: GLPBio, Chemat. Available pack sizes: 5g, 100g.
2-nitropyridin-3-ol (CAS 15128-08-2) is a chemical compound with the molecular formula C5H4N2O3 and a molecular weight of 140.10 g/mol. IUPAC name: 2-nitropyridin-3-ol. InChIKey: QBPDSKPWYWIHGA-UHFFFAOYSA-N.
| Molecular formula | C5H4N2O3 |
|---|---|
| Molecular weight | 140.10 g/mol |
| IUPAC name | 2-nitropyridin-3-ol |
| InChIKey | QBPDSKPWYWIHGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)[N+](=O)[O-])O |
Computed by PubChem (NCBI)