Products 151504-81-3
CAS 151504-81-3 appears in our catalog under these names: Methyl 4-fluoro-2-nitrobenzoate, 95-<97%, Methyl 4-fluoro-2-nitrobenzoate, ≥97-<99%, Methyl 4–Fluoro–2–nitrobenzoate, Methyl 4-fluoro-2-nitrobenzoate 97%, Methyl 4-Fluoro-2-nitrobenzoate, 97%, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 200g, 300g, 400g, 500g, 600g, 1g, 25g.
Methyl 4-fluoro-2-nitrobenzoate (CAS 151504-81-3) is a chemical compound with the molecular formula C8H6FNO4 and a molecular weight of 199.14 g/mol. IUPAC name: methyl 4-fluoro-2-nitrobenzoate. InChIKey: YBAZOLISUXINHV-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO4 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | methyl 4-fluoro-2-nitrobenzoate |
| InChIKey | YBAZOLISUXINHV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)