Products 151590-36-2
CAS 151590-36-2 appears in our catalog under these names: (E)-3-(6-Methyl-1h-indol-3-yl)acrylic acid, 95%, (E)-3-(6-Methyl-1H-indol-3-yl)acrylic acid, 95+%, (E)–3–(6–Methyl–1H–indol–3–yl)acrylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
(E)-3-(6-methyl-1H-indol-3-yl)prop-2-enoic acid (CAS 151590-36-2) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: (E)-3-(6-methyl-1H-indol-3-yl)prop-2-enoic acid. InChIKey: UCCFXXRAQYXSLZ-HWKANZROSA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (E)-3-(6-methyl-1H-indol-3-yl)prop-2-enoic acid |
| InChIKey | UCCFXXRAQYXSLZ-HWKANZROSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)/C=C/C(=O)O |
Computed by PubChem (NCBI)