Products 1515961-07-5

CAS 1515961-07-5 is the registry number for Argatroban Impurity 89. Offered by: Chemat Brand. Available pack sizes: on request.

3-methylquinoline-8-sulfinic acid (CAS 1515961-07-5) is a chemical compound with the molecular formula C10H9NO2S and a molecular weight of 207.25 g/mol. IUPAC name: 3-methylquinoline-8-sulfinic acid. InChIKey: RLCYUBNINIQLBX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9NO2S
Molecular weight207.25 g/mol
IUPAC name3-methylquinoline-8-sulfinic acid
InChIKeyRLCYUBNINIQLBX-UHFFFAOYSA-N
SMILESCC1=CC2=C(C(=CC=C2)S(=O)O)N=C1

Computed by PubChem (NCBI)