CAS 1517344-87-4 appears in our catalog under these names: 2,2-Dimethyl-6-(trifluoromethyl)-2H-benzo(b)(1,4)oxazin-3(4H)-one, 95%, 2,2-Dimethyl-6-(trifluoromethyl)-3,4-dihydro-2H-1,4-benzoxazin-3-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one (CAS 1517344-87-4) is a chemical compound with the molecular formula C11H10F3NO2 and a molecular weight of 245.20 g/mol. IUPAC name: 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one. InChIKey: KVGQIRCTCZFWNN-UHFFFAOYSA-N.
| Molecular formula | C11H10F3NO2 |
|---|---|
| Molecular weight | 245.20 g/mol |
| IUPAC name | 2,2-dimethyl-6-(trifluoromethyl)-4H-1,4-benzoxazin-3-one |
| InChIKey | KVGQIRCTCZFWNN-UHFFFAOYSA-N |
| SMILES | CC1(C(=O)NC2=C(O1)C=CC(=C2)C(F)(F)F)C |
Computed by PubChem (NCBI)