CAS 1518990-83-4 is the registry number for 2-{5H,6H,7H-Pyrazolo(3,2-b)(1,3)oxazin-2-yl}acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)acetic acid (CAS 1518990-83-4) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 2-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)acetic acid. InChIKey: VMZIBBSZULIYNA-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 2-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-2-yl)acetic acid |
| InChIKey | VMZIBBSZULIYNA-UHFFFAOYSA-N |
| SMILES | C1CN2C(=CC(=N2)CC(=O)O)OC1 |
Computed by PubChem (NCBI)